PRODUCTS
PRODUCTS
2-chloro-5-chloromethylpyridine |
| Product name: | 2-chloro-5-chloromethylpyridine |
| CAS No.: | 70258-18-3 |
| Molecular weight: | 162.0166 |
| Molecular formula: | C6H5Cl2N |
| InChI: | InChI=1/C6H5Cl2N/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3 |
| Structural formula: |  |
| Density: | 1.319g/cm3 |
| Melting point: | 37-42℃ |
| Boiling point: | 219.3°C at 760 mmHg |
| Flash point: | 107.3°C |
| Vapor pressure: | 0.177mmHg at 25°C |
| Uses: | Used as pesticide imidacloprid and dimimidine intermediates;2- chloro-5-chloromethylpyridine is the intermediate of imidacloprid and dimedimide. |
